What is the density of isoprene?

681 kg/m³Isoprene / Density

Why does isoprene have a higher boiling point than pentane?

The n-pentane melts higher than isopentane because it can assume a rodlike shape in which adjacent molecules can pack closely together. The spherical neopentane molecules exert relatively little attraction on each other and so have a low boiling point.

Which is the structural formula of isoprene?

C5H8Isoprene / Formula

What is the IUPAC name of the isoprene molecule?

IUPAC Name	2-methylbuta-1,3-diene
Alternative Names	ISOPRENE 2-Methyl-1,3-butadiene Isopentadiene 2-Methylbutadiene 1,3-Butadiene, 2-methyl-
Molecular Formula	C5H8
Molar Mass	68.119 g/mol
InChI	InChI=1S/C5H8/c1-4-5(2)3/h4H,1-2H2,3H3

Does isoprene dissolve in water?

Solubility : Soluble in water (0.7 mg/ml at 20° C), chloroform, ether, acetone, and methanol. Melting Point : -146° C (lit.)

Is isoprene soluble in water?

Isoprene has a water solubility of 642 mg/l (25° C), a log Kow of 2.42, and a density of 0.681 g/cm3 (25° C).

What functional group is isoprene?

Isoprene (2-methyl-1,3-butadiene) is a branched-chain unsaturated hydrocarbon, unsaturated meaning it contains one or more double bonds between carbon atoms. The carbon backbone of an isoprenoid can have one or more functional chemical groups, such as hydroxyl and carbonyl, attached to it.

What elements are in isoprene?

KEY FACTS

OTHER NAMES: 2-methyl-1,3-butadiene.
FORMULA: CH2=CH(CH3)CH=CH2
ELEMENTS: Carbon, hydrogen.
COMPOUND TYPE: Alkadiene; unsaturated hydrocarbon (organic)
STATE: Liquid.
MOLECULAR WEIGHT: 68.12 g/mol.
MELTING POINT: −145.9°C (−230.6°F)
BOILING POINT: 34.0°C (93.2°F)

What is isoprene soluble?

Isoprene: sc-250194. Solubility : Soluble in water (0.7 mg/ml at 20° C), chloroform, ether, acetone, and methanol. Storage : Store at 4° C.